C26H28FN3O4S — CID 69160024
7-[2-[2-[2-[[2-(2-fluorophenyl)ethylamino]methyl]phenyl]ethylamino]-1,2-dihydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one (PubChem CID 69160024) has the molecular formula C26H28FN3O4S and a molecular weight of 497.59 g/mol. Its IUPAC name is 7-[2-[2-[2-[[2-(2-fluorophenyl)ethylamino]methyl]phenyl]ethylamino]-1,2-dihydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one.
| Compound Name | 7-[2-[2-[2-[[2-(2-fluorophenyl)ethylamino]methyl]phenyl]ethylamino]-1,2-dihydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 69160024 |
| Molecular Formula | C26H28FN3O4S |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 7-[2-[2-[2-[[2-(2-fluorophenyl)ethylamino]methyl]phenyl]ethylamino]-1,2-dihydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2c(O)ccc(C(O)C(O)NCCc3ccccc3CNCCc3ccccc3F)c2s1 |
| InChI | InChI=1S/C26H28FN3O4S/c27-20-8-4-3-6-17(20)11-13-28-15-18-7-2-1-5-16(18)12-14-29-25(33)23(32)19-9-10-21(31)22-24(19)35-26(34)30-22/h1-10,23,25,28-29,31-33H,11-15H2,(H,30,34) |
| InChIKey | XBVFIVYGJQLGBO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|