C24H23Cl3N4O — CID 69163024
12-chloro-N-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaene-5-carboxamide (PubChem CID 69163024) has the molecular formula C24H23Cl3N4O and a molecular weight of 489.83 g/mol. Its IUPAC name is 12-chloro-N-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaene-5-carboxamide.
| Compound Name | 12-chloro-N-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 69163024 |
| Molecular Formula | C24H23Cl3N4O |
| Molecular Weight | 489.83 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 12-chloro-N-(2,4-dichlorophenyl)-N-piperidin-1-yl-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaene-5-carboxamide |
| SMILES | O=C(c1[nH]nc2c1CCCc1cc(Cl)ccc1-2)N(c1ccc(Cl)cc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C24H23Cl3N4O/c25-16-7-9-18-15(13-16)5-4-6-19-22(18)28-29-23(19)24(32)31(30-11-2-1-3-12-30)21-10-8-17(26)14-20(21)27/h7-10,13-14H,1-6,11-12H2,(H,28,29) |
| InChIKey | WILZAXINVHFTCS-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.83 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |