C16H11ClF3NO2 — CID 69163750
1-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-6,7-dihydroindole-2,3-dione (PubChem CID 69163750) has the molecular formula C16H11ClF3NO2 and a molecular weight of 341.72 g/mol. Its IUPAC name is 1-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-6,7-dihydroindole-2,3-dione.
| Compound Name | 1-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-6,7-dihydroindole-2,3-dione |
|---|---|
| PubChem CID | 69163750 |
| Molecular Formula | C16H11ClF3NO2 |
| Molecular Weight | 341.72 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 1-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-6,7-dihydroindole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccc(Cl)c(C(F)(F)F)c2)C2=C1C=CCC2 |
| InChI | InChI=1S/C16H11ClF3NO2/c17-12-6-5-9(7-11(12)16(18,19)20)8-21-13-4-2-1-3-10(13)14(22)15(21)23/h1,3,5-7H,2,4,8H2 |
| InChIKey | ULSWBZMGNRMCHW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.72 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|