C17H14ClFINO4S — CID 69164995
methyl 3-[(4-chloro-2-fluorobenzoyl)-(oxolan-3-yl)amino]-5-iodothiophene-2-carboxylate (PubChem CID 69164995) has the molecular formula C17H14ClFINO4S and a molecular weight of 509.72 g/mol. Its IUPAC name is methyl 3-[(4-chloro-2-fluorobenzoyl)-(oxolan-3-yl)amino]-5-iodothiophene-2-carboxylate.
| Compound Name | methyl 3-[(4-chloro-2-fluorobenzoyl)-(oxolan-3-yl)amino]-5-iodothiophene-2-carboxylate |
|---|---|
| PubChem CID | 69164995 |
| Molecular Formula | C17H14ClFINO4S |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 508.94 |
| IUPAC Name | methyl 3-[(4-chloro-2-fluorobenzoyl)-(oxolan-3-yl)amino]-5-iodothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(I)cc1N(C(=O)c1ccc(Cl)cc1F)C1CCOC1 |
| InChI | InChI=1S/C17H14ClFINO4S/c1-24-17(23)15-13(7-14(20)26-15)21(10-4-5-25-8-10)16(22)11-3-2-9(18)6-12(11)19/h2-3,6-7,10H,4-5,8H2,1H3 |
| InChIKey | FOWXIYKRFSNUQA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|