C24H24Cl2N2O — CID 69166105
3-(4-chlorophenyl)-N-[3-(4-chlorophenyl)-3-(dimethylamino)propyl]benzamide (PubChem CID 69166105) has the molecular formula C24H24Cl2N2O and a molecular weight of 427.38 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[3-(4-chlorophenyl)-3-(dimethylamino)propyl]benzamide.
| Compound Name | 3-(4-chlorophenyl)-N-[3-(4-chlorophenyl)-3-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 69166105 |
| Molecular Formula | C24H24Cl2N2O |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[3-(4-chlorophenyl)-3-(dimethylamino)propyl]benzamide |
| SMILES | CN(C)C(CCNC(=O)c1cccc(-c2ccc(Cl)cc2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24Cl2N2O/c1-28(2)23(18-8-12-22(26)13-9-18)14-15-27-24(29)20-5-3-4-19(16-20)17-6-10-21(25)11-7-17/h3-13,16,23H,14-15H2,1-2H3,(H,27,29) |
| InChIKey | FNHSUJXUTMDNRU-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |