C18H18N2O4S — CID 69166117
4-[(3-methyl-10H-phenothiazin-2-yl)carbamoyloxy]butanoic acid (PubChem CID 69166117) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 4-[(3-methyl-10H-phenothiazin-2-yl)carbamoyloxy]butanoic acid.
| Compound Name | 4-[(3-methyl-10H-phenothiazin-2-yl)carbamoyloxy]butanoic acid |
|---|---|
| PubChem CID | 69166117 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-[(3-methyl-10H-phenothiazin-2-yl)carbamoyloxy]butanoic acid |
| SMILES | Cc1cc2c(cc1NC(=O)OCCCC(=O)O)Nc1ccccc1S2 |
| InChI | InChI=1S/C18H18N2O4S/c1-11-9-16-14(19-12-5-2-3-6-15(12)25-16)10-13(11)20-18(23)24-8-4-7-17(21)22/h2-3,5-6,9-10,19H,4,7-8H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | YDIZNPFTUIIUOO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|