C14H19ClN2O2 — CID 69167635
N-[2-(2-chloro-5-methoxy-2-methyl-1,3-dihydroindol-3-yl)ethyl]acetamide (PubChem CID 69167635) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is N-[2-(2-chloro-5-methoxy-2-methyl-1,3-dihydroindol-3-yl)ethyl]acetamide.
| Compound Name | N-[2-(2-chloro-5-methoxy-2-methyl-1,3-dihydroindol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 69167635 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-[2-(2-chloro-5-methoxy-2-methyl-1,3-dihydroindol-3-yl)ethyl]acetamide |
| SMILES | COc1ccc2c(c1)C(CCNC(C)=O)C(C)(Cl)N2 |
| InChI | InChI=1S/C14H19ClN2O2/c1-9(18)16-7-6-12-11-8-10(19-3)4-5-13(11)17-14(12,2)15/h4-5,8,12,17H,6-7H2,1-3H3,(H,16,18) |
| InChIKey | BODGZXOMKRJJDX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|