C18H13NO4 — CID 69167722
7-quinolin-6-yl-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid (PubChem CID 69167722) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is 7-quinolin-6-yl-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid.
| Compound Name | 7-quinolin-6-yl-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid |
|---|---|
| PubChem CID | 69167722 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 7-quinolin-6-yl-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc3ncccc3c2)cc2c1OCCO2 |
| InChI | InChI=1S/C18H13NO4/c20-18(21)14-9-13(10-16-17(14)23-7-6-22-16)11-3-4-15-12(8-11)2-1-5-19-15/h1-5,8-10H,6-7H2,(H,20,21) |
| InChIKey | PESPFPRHIGZXSB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |