C20H13NO4 — CID 178046081
9-quinolin-6-yl-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-7-one (PubChem CID 178046081) has the molecular formula C20H13NO4 and a molecular weight of 331.33 g/mol. Its IUPAC name is 9-quinolin-6-yl-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-7-one.
| Compound Name | 9-quinolin-6-yl-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-7-one |
|---|---|
| PubChem CID | 178046081 |
| Molecular Formula | C20H13NO4 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 9-quinolin-6-yl-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-7-one |
| SMILES | O=c1cc(-c2ccc3ncccc3c2)oc2c3c(ccc12)OCCO3 |
| InChI | InChI=1S/C20H13NO4/c22-16-11-18(13-3-5-15-12(10-13)2-1-7-21-15)25-19-14(16)4-6-17-20(19)24-9-8-23-17/h1-7,10-11H,8-9H2 |
| InChIKey | LEOBNWYLURNFFP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |