C30H49N3O2S — CID 69173674
(4R)-2-(2-acetamidophenyl)-N-octadec-8-enyl-1,3-thiazolidine-4-carboxamide (PubChem CID 69173674) has the molecular formula C30H49N3O2S and a molecular weight of 515.81 g/mol. Its IUPAC name is (4R)-2-(2-acetamidophenyl)-N-octadec-8-enyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-2-(2-acetamidophenyl)-N-octadec-8-enyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 69173674 |
| Molecular Formula | C30H49N3O2S |
| Molecular Weight | 515.81 g/mol |
| Exact Mass | 515.35 |
| IUPAC Name | (4R)-2-(2-acetamidophenyl)-N-octadec-8-enyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCCCCCCCC=CCCCCCCCNC(=O)[C@@H]1CSC(c2ccccc2NC(C)=O)N1 |
| InChI | InChI=1S/C30H49N3O2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-23-31-29(35)28-24-36-30(33-28)26-21-18-19-22-27(26)32-25(2)34/h11-12,18-19,21-22,28,30,33H,3-10,13-17,20,23-24H2,1-2H3,(H,31,35)(H,32,34)/t28-,30?/m0/s1 |
| InChIKey | WCXJQSYJZKDQSS-MBCWZBCWSA-N |
| XLogP | 7.50 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.81 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|