C19H21F3O5 — CID 6917394
(3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) 2,2,2-trifluoroacetate (PubChem CID 6917394) has the molecular formula C19H21F3O5 and a molecular weight of 386.37 g/mol. Its IUPAC name is (3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) 2,2,2-trifluoroacetate.
| Compound Name | (3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 6917394 |
| Molecular Formula | C19H21F3O5 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (3-heptyl-7-methyl-6,8-dioxoisochromen-7-yl) 2,2,2-trifluoroacetate |
| SMILES | CCCCCCCC1=CC2=CC(=O)C(C)(OC(=O)C(F)(F)F)C(=O)C2=CO1 |
| InChI | InChI=1S/C19H21F3O5/c1-3-4-5-6-7-8-13-9-12-10-15(23)18(2,16(24)14(12)11-26-13)27-17(25)19(20,21)22/h9-11H,3-8H2,1-2H3 |
| InChIKey | LIXKRTCVTQTWTO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|