C17H19ClO6 — CID 16680643
[(7S)-5-chloro-3-(3-hydroxypropyl)-7-methyl-6,8-dioxoisochromen-7-yl] butanoate (PubChem CID 16680643) has the molecular formula C17H19ClO6 and a molecular weight of 354.79 g/mol. Its IUPAC name is [(7S)-5-chloro-3-(3-hydroxypropyl)-7-methyl-6,8-dioxoisochromen-7-yl] butanoate.
| Compound Name | [(7S)-5-chloro-3-(3-hydroxypropyl)-7-methyl-6,8-dioxoisochromen-7-yl] butanoate |
|---|---|
| PubChem CID | 16680643 |
| Molecular Formula | C17H19ClO6 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [(7S)-5-chloro-3-(3-hydroxypropyl)-7-methyl-6,8-dioxoisochromen-7-yl] butanoate |
| SMILES | CCCC(=O)O[C@@]1(C)C(=O)C2=COC(CCCO)=CC2=C(Cl)C1=O |
| InChI | InChI=1S/C17H19ClO6/c1-3-5-13(20)24-17(2)15(21)12-9-23-10(6-4-7-19)8-11(12)14(18)16(17)22/h8-9,19H,3-7H2,1-2H3/t17-/m0/s1 |
| InChIKey | CFJJWGJKXFNLMK-KRWDZBQOSA-N |
| XLogP | 2.30 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|