C33H37ClO6Si — CID 102478753
[(7R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-chloro-7-methyl-6,8-dioxoisochromen-7-yl] butanoate (PubChem CID 102478753) has the molecular formula C33H37ClO6Si and a molecular weight of 593.19 g/mol. Its IUPAC name is [(7R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-chloro-7-methyl-6,8-dioxoisochromen-7-yl] butanoate.
| Compound Name | [(7R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-chloro-7-methyl-6,8-dioxoisochromen-7-yl] butanoate |
|---|---|
| PubChem CID | 102478753 |
| Molecular Formula | C33H37ClO6Si |
| Molecular Weight | 593.19 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | [(7R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-chloro-7-methyl-6,8-dioxoisochromen-7-yl] butanoate |
| SMILES | CCCC(=O)O[C@]1(C)C(=O)C2=COC(CCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)=CC2=C(Cl)C1=O |
| InChI | InChI=1S/C33H37ClO6Si/c1-6-14-28(35)40-33(5)30(36)27-22-38-23(21-26(27)29(34)31(33)37)15-13-20-39-41(32(2,3)4,24-16-9-7-10-17-24)25-18-11-8-12-19-25/h7-12,16-19,21-22H,6,13-15,20H2,1-5H3/t33-/m1/s1 |
| InChIKey | RJMAGJPSQAKIHH-MGBGTMOVSA-N |
| XLogP | 5.89 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.19 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|