C24H24N4O4 — CID 69174107
4-(3-aminophenyl)-N-[(2R)-2,3-dihydroxypropyl]-2-methyl-5-[(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxamide (PubChem CID 69174107) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 4-(3-aminophenyl)-N-[(2R)-2,3-dihydroxypropyl]-2-methyl-5-[(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 4-(3-aminophenyl)-N-[(2R)-2,3-dihydroxypropyl]-2-methyl-5-[(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 69174107 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 4-(3-aminophenyl)-N-[(2R)-2,3-dihydroxypropyl]-2-methyl-5-[(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]c(C=C2C(=O)Nc3ccccc32)c(-c2cccc(N)c2)c1C(=O)NC[C@@H](O)CO |
| InChI | InChI=1S/C24H24N4O4/c1-13-21(24(32)26-11-16(30)12-29)22(14-5-4-6-15(25)9-14)20(27-13)10-18-17-7-2-3-8-19(17)28-23(18)31/h2-10,16,27,29-30H,11-12,25H2,1H3,(H,26,32)(H,28,31)/t16-/m1/s1 |
| InChIKey | PVLWQFKCSAQXOM-MRXNPFEDSA-N |
| XLogP | 2.15 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|