C24H30F3N3O3 — CID 69174902
7-[2-[4-[2-methoxy-5-(trifluoromethyl)phenyl]piperazin-1-yl]ethoxy]-2,2-dimethyl-3H-1-benzofuran-5-amine (PubChem CID 69174902) has the molecular formula C24H30F3N3O3 and a molecular weight of 465.52 g/mol. Its IUPAC name is 7-[2-[4-[2-methoxy-5-(trifluoromethyl)phenyl]piperazin-1-yl]ethoxy]-2,2-dimethyl-3H-1-benzofuran-5-amine.
| Compound Name | 7-[2-[4-[2-methoxy-5-(trifluoromethyl)phenyl]piperazin-1-yl]ethoxy]-2,2-dimethyl-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 69174902 |
| Molecular Formula | C24H30F3N3O3 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 7-[2-[4-[2-methoxy-5-(trifluoromethyl)phenyl]piperazin-1-yl]ethoxy]-2,2-dimethyl-3H-1-benzofuran-5-amine |
| SMILES | COc1ccc(C(F)(F)F)cc1N1CCN(CCOc2cc(N)cc3c2OC(C)(C)C3)CC1 |
| InChI | InChI=1S/C24H30F3N3O3/c1-23(2)15-16-12-18(28)14-21(22(16)33-23)32-11-10-29-6-8-30(9-7-29)19-13-17(24(25,26)27)4-5-20(19)31-3/h4-5,12-14H,6-11,15,28H2,1-3H3 |
| InChIKey | PQFJELPPTNLSFP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 60.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|