C22H25NO4 — CID 69175835
[cyclohexylmethylcarbamoyloxy(phenyl)methyl] benzoate (PubChem CID 69175835) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is [cyclohexylmethylcarbamoyloxy(phenyl)methyl] benzoate.
| Compound Name | [cyclohexylmethylcarbamoyloxy(phenyl)methyl] benzoate |
|---|---|
| PubChem CID | 69175835 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [cyclohexylmethylcarbamoyloxy(phenyl)methyl] benzoate |
| SMILES | O=C(NCC1CCCCC1)OC(OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO4/c24-20(18-12-6-2-7-13-18)26-21(19-14-8-3-9-15-19)27-22(25)23-16-17-10-4-1-5-11-17/h2-3,6-9,12-15,17,21H,1,4-5,10-11,16H2,(H,23,25) |
| InChIKey | CLFQUEZOZCIVRC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|