C17H17ClF3N3O — CID 69176196
6-amino-3-(4-chlorophenyl)-2-[4-(trifluoromethyl)cyclohexyl]pyrimidin-4-one (PubChem CID 69176196) has the molecular formula C17H17ClF3N3O and a molecular weight of 371.79 g/mol. Its IUPAC name is 6-amino-3-(4-chlorophenyl)-2-[4-(trifluoromethyl)cyclohexyl]pyrimidin-4-one.
| Compound Name | 6-amino-3-(4-chlorophenyl)-2-[4-(trifluoromethyl)cyclohexyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 69176196 |
| Molecular Formula | C17H17ClF3N3O |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 6-amino-3-(4-chlorophenyl)-2-[4-(trifluoromethyl)cyclohexyl]pyrimidin-4-one |
| SMILES | Nc1cc(=O)n(-c2ccc(Cl)cc2)c(C2CCC(C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C17H17ClF3N3O/c18-12-5-7-13(8-6-12)24-15(25)9-14(22)23-16(24)10-1-3-11(4-2-10)17(19,20)21/h5-11H,1-4,22H2 |
| InChIKey | YYOVPCLMXTYMFO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |