C19H17BrF3N3O — CID 25123158
4-[5-bromo-4-methyl-6-oxo-2-[4-(trifluoromethyl)cyclohexyl]pyrimidin-1-yl]benzonitrile (PubChem CID 25123158) has the molecular formula C19H17BrF3N3O and a molecular weight of 440.26 g/mol. Its IUPAC name is 4-[5-bromo-4-methyl-6-oxo-2-[4-(trifluoromethyl)cyclohexyl]pyrimidin-1-yl]benzonitrile.
| Compound Name | 4-[5-bromo-4-methyl-6-oxo-2-[4-(trifluoromethyl)cyclohexyl]pyrimidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 25123158 |
| Molecular Formula | C19H17BrF3N3O |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 4-[5-bromo-4-methyl-6-oxo-2-[4-(trifluoromethyl)cyclohexyl]pyrimidin-1-yl]benzonitrile |
| SMILES | Cc1nc(C2CCC(C(F)(F)F)CC2)n(-c2ccc(C#N)cc2)c(=O)c1Br |
| InChI | InChI=1S/C19H17BrF3N3O/c1-11-16(20)18(27)26(15-8-2-12(10-24)3-9-15)17(25-11)13-4-6-14(7-5-13)19(21,22)23/h2-3,8-9,13-14H,4-7H2,1H3 |
| InChIKey | RCGONZJLNLMJFH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |