C20H19F3N6O — CID 69095749
5-[9-ethyl-6-oxo-2-[4-(trifluoromethyl)cyclohexyl]purin-3-yl]pyridine-2-carbonitrile (PubChem CID 69095749) has the molecular formula C20H19F3N6O and a molecular weight of 416.41 g/mol. Its IUPAC name is 5-[9-ethyl-6-oxo-2-[4-(trifluoromethyl)cyclohexyl]purin-3-yl]pyridine-2-carbonitrile.
| Compound Name | 5-[9-ethyl-6-oxo-2-[4-(trifluoromethyl)cyclohexyl]purin-3-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 69095749 |
| Molecular Formula | C20H19F3N6O |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 5-[9-ethyl-6-oxo-2-[4-(trifluoromethyl)cyclohexyl]purin-3-yl]pyridine-2-carbonitrile |
| SMILES | CCn1cnc2c(=O)nc(C3CCC(C(F)(F)F)CC3)n(-c3ccc(C#N)nc3)c21 |
| InChI | InChI=1S/C20H19F3N6O/c1-2-28-11-26-16-18(30)27-17(12-3-5-13(6-4-12)20(21,22)23)29(19(16)28)15-8-7-14(9-24)25-10-15/h7-8,10-13H,2-6H2,1H3 |
| InChIKey | FJAGEQFZPAOBLA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 89.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |