C17H15ClF3N3O3 — CID 87723404
3-(6-chloro-3-pyridinyl)-6-oxo-2-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4-carboxylic acid (PubChem CID 87723404) has the molecular formula C17H15ClF3N3O3 and a molecular weight of 401.77 g/mol. Its IUPAC name is 3-(6-chloro-3-pyridinyl)-6-oxo-2-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4-carboxylic acid.
| Compound Name | 3-(6-chloro-3-pyridinyl)-6-oxo-2-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 87723404 |
| Molecular Formula | C17H15ClF3N3O3 |
| Molecular Weight | 401.77 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 3-(6-chloro-3-pyridinyl)-6-oxo-2-[4-(trifluoromethyl)cyclohexyl]pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)nc(C2CCC(C(F)(F)F)CC2)n1-c1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H15ClF3N3O3/c18-13-6-5-11(8-22-13)24-12(16(26)27)7-14(25)23-15(24)9-1-3-10(4-2-9)17(19,20)21/h5-10H,1-4H2,(H,26,27) |
| InChIKey | CMTLUHJHFGPYOS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.77 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|