C16H18IN3O2 — CID 69177534
N-(2-iodo-1-azabicyclo[2.2.2]octan-3-yl)-2-methyl-1,3-benzoxazole-4-carboxamide (PubChem CID 69177534) has the molecular formula C16H18IN3O2 and a molecular weight of 411.24 g/mol. Its IUPAC name is N-(2-iodo-1-azabicyclo[2.2.2]octan-3-yl)-2-methyl-1,3-benzoxazole-4-carboxamide.
| Compound Name | N-(2-iodo-1-azabicyclo[2.2.2]octan-3-yl)-2-methyl-1,3-benzoxazole-4-carboxamide |
|---|---|
| PubChem CID | 69177534 |
| Molecular Formula | C16H18IN3O2 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | N-(2-iodo-1-azabicyclo[2.2.2]octan-3-yl)-2-methyl-1,3-benzoxazole-4-carboxamide |
| SMILES | Cc1nc2c(C(=O)NC3C4CCN(CC4)C3I)cccc2o1 |
| InChI | InChI=1S/C16H18IN3O2/c1-9-18-14-11(3-2-4-12(14)22-9)16(21)19-13-10-5-7-20(8-6-10)15(13)17/h2-4,10,13,15H,5-8H2,1H3,(H,19,21) |
| InChIKey | DNYHOBFZOREJAG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|