C22H21ClIN3O3 — CID 69369270
2-(4-chloro-2-methoxyphenyl)-N-(2-iodo-1-azabicyclo[2.2.2]octan-3-yl)-1,3-benzoxazole-4-carboxamide (PubChem CID 69369270) has the molecular formula C22H21ClIN3O3 and a molecular weight of 537.79 g/mol. Its IUPAC name is 2-(4-chloro-2-methoxyphenyl)-N-(2-iodo-1-azabicyclo[2.2.2]octan-3-yl)-1,3-benzoxazole-4-carboxamide.
| Compound Name | 2-(4-chloro-2-methoxyphenyl)-N-(2-iodo-1-azabicyclo[2.2.2]octan-3-yl)-1,3-benzoxazole-4-carboxamide |
|---|---|
| PubChem CID | 69369270 |
| Molecular Formula | C22H21ClIN3O3 |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 537.03 |
| IUPAC Name | 2-(4-chloro-2-methoxyphenyl)-N-(2-iodo-1-azabicyclo[2.2.2]octan-3-yl)-1,3-benzoxazole-4-carboxamide |
| SMILES | COc1cc(Cl)ccc1-c1nc2c(C(=O)NC3C4CCN(CC4)C3I)cccc2o1 |
| InChI | InChI=1S/C22H21ClIN3O3/c1-29-17-11-13(23)5-6-14(17)22-26-19-15(3-2-4-16(19)30-22)21(28)25-18-12-7-9-27(10-8-12)20(18)24/h2-6,11-12,18,20H,7-10H2,1H3,(H,25,28) |
| InChIKey | SBMIAQTWDWDZOM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|