C15H10ClNO4 — CID 81340585
2-(4-chloro-2-methoxyphenyl)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 81340585) has the molecular formula C15H10ClNO4 and a molecular weight of 303.70 g/mol. Its IUPAC name is 2-(4-chloro-2-methoxyphenyl)-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(4-chloro-2-methoxyphenyl)-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 81340585 |
| Molecular Formula | C15H10ClNO4 |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-(4-chloro-2-methoxyphenyl)-1,3-benzoxazole-6-carboxylic acid |
| SMILES | COc1cc(Cl)ccc1-c1nc2ccc(C(=O)O)cc2o1 |
| InChI | InChI=1S/C15H10ClNO4/c1-20-12-7-9(16)3-4-10(12)14-17-11-5-2-8(15(18)19)6-13(11)21-14/h2-7H,1H3,(H,18,19) |
| InChIKey | DIUHYHAEGKMBJF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |