C19H13ClFN5O — CID 69180796
4-[4-(3-chloro-4-fluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]benzamide (PubChem CID 69180796) has the molecular formula C19H13ClFN5O and a molecular weight of 381.80 g/mol. Its IUPAC name is 4-[4-(3-chloro-4-fluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]benzamide.
| Compound Name | 4-[4-(3-chloro-4-fluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]benzamide |
|---|---|
| PubChem CID | 69180796 |
| Molecular Formula | C19H13ClFN5O |
| Molecular Weight | 381.80 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 4-[4-(3-chloro-4-fluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2cc3c(Nc4ccc(F)c(Cl)c4)ncnc3[nH]2)cc1 |
| InChI | InChI=1S/C19H13ClFN5O/c20-14-7-12(5-6-15(14)21)25-18-13-8-16(26-19(13)24-9-23-18)10-1-3-11(4-2-10)17(22)27/h1-9H,(H2,22,27)(H2,23,24,25,26) |
| InChIKey | HKYROYWYMLEPSB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.80 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |