C19H27ClN4O4 — CID 69184819
5-[[3-[(2-ethoxyacetyl)amino]-1,5-naphthyridin-4-yl]amino]pentyl acetate;hydrochloride (PubChem CID 69184819) has the molecular formula C19H27ClN4O4 and a molecular weight of 410.90 g/mol. Its IUPAC name is 5-[[3-[(2-ethoxyacetyl)amino]-1,5-naphthyridin-4-yl]amino]pentyl acetate;hydrochloride.
| Compound Name | 5-[[3-[(2-ethoxyacetyl)amino]-1,5-naphthyridin-4-yl]amino]pentyl acetate;hydrochloride |
|---|---|
| PubChem CID | 69184819 |
| Molecular Formula | C19H27ClN4O4 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 5-[[3-[(2-ethoxyacetyl)amino]-1,5-naphthyridin-4-yl]amino]pentyl acetate;hydrochloride |
| SMILES | CCOCC(=O)Nc1cnc2cccnc2c1NCCCCCOC(C)=O.Cl |
| InChI | InChI=1S/C19H26N4O4.ClH/c1-3-26-13-17(25)23-16-12-22-15-8-7-10-21-18(15)19(16)20-9-5-4-6-11-27-14(2)24;/h7-8,10,12H,3-6,9,11,13H2,1-2H3,(H,20,22)(H,23,25);1H |
| InChIKey | WXSRNUDIGDMIIJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|