C22H21FN4O2 — CID 69188638
N-(4-fluorophenyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]pyridine-3-carboxamide (PubChem CID 69188638) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]pyridine-3-carboxamide.
| Compound Name | N-(4-fluorophenyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69188638 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-(4-fluorophenyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(c1cccnc1)N(Cc1ccc(N2CCOCC2)nc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN4O2/c23-19-4-6-20(7-5-19)27(22(28)18-2-1-9-24-15-18)16-17-3-8-21(25-14-17)26-10-12-29-13-11-26/h1-9,14-15H,10-13,16H2 |
| InChIKey | ICJYVSHVNGACOE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |