C19H21N3 — CID 69188935
N-methyl-1-[(1S,3S)-1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]methanamine (PubChem CID 69188935) has the molecular formula C19H21N3 and a molecular weight of 291.40 g/mol. Its IUPAC name is N-methyl-1-[(1S,3S)-1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]methanamine.
| Compound Name | N-methyl-1-[(1S,3S)-1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]methanamine |
|---|---|
| PubChem CID | 69188935 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-methyl-1-[(1S,3S)-1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]methanamine |
| SMILES | CNC[C@@H]1Cc2c([nH]c3ccccc23)[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C19H21N3/c1-20-12-14-11-16-15-9-5-6-10-17(15)22-19(16)18(21-14)13-7-3-2-4-8-13/h2-10,14,18,20-22H,11-12H2,1H3/t14-,18-/m0/s1 |
| InChIKey | PFAKAENAXAZQFS-KSSFIOAISA-N |
| XLogP | 2.99 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|