C21H23FN2 — CID 177284249
3-butyl-1-(4-fluorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 177284249) has the molecular formula C21H23FN2 and a molecular weight of 322.43 g/mol. Its IUPAC name is 3-butyl-1-(4-fluorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 3-butyl-1-(4-fluorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 177284249 |
| Molecular Formula | C21H23FN2 |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 3-butyl-1-(4-fluorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | CCCCC1Cc2c([nH]c3ccccc23)C(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C21H23FN2/c1-2-3-6-16-13-18-17-7-4-5-8-19(17)24-21(18)20(23-16)14-9-11-15(22)12-10-14/h4-5,7-12,16,20,23-24H,2-3,6,13H2,1H3 |
| InChIKey | HJXUIOFZPVEUOH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|