C26H32F2N4 — CID 164823367
(1S,3S)-3-butyl-6,8-difluoro-1-[4-(4-methylpiperazin-1-yl)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 164823367) has the molecular formula C26H32F2N4 and a molecular weight of 438.57 g/mol. Its IUPAC name is (1S,3S)-3-butyl-6,8-difluoro-1-[4-(4-methylpiperazin-1-yl)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (1S,3S)-3-butyl-6,8-difluoro-1-[4-(4-methylpiperazin-1-yl)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 164823367 |
| Molecular Formula | C26H32F2N4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | (1S,3S)-3-butyl-6,8-difluoro-1-[4-(4-methylpiperazin-1-yl)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | CCCC[C@H]1Cc2c([nH]c3c(F)cc(F)cc23)[C@H](c2ccc(N3CCN(C)CC3)cc2)N1 |
| InChI | InChI=1S/C26H32F2N4/c1-3-4-5-19-16-22-21-14-18(27)15-23(28)25(21)30-26(22)24(29-19)17-6-8-20(9-7-17)32-12-10-31(2)11-13-32/h6-9,14-15,19,24,29-30H,3-5,10-13,16H2,1-2H3/t19-,24-/m0/s1 |
| InChIKey | UFOLKIITHRISBW-CYFREDJKSA-N |
| XLogP | 4.99 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|