C24H28F2N2O2 — CID 164823347
1-[(1S,3S)-3-butyl-6,8-difluoro-1-(4-hydroxycyclohexyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one (PubChem CID 164823347) has the molecular formula C24H28F2N2O2 and a molecular weight of 414.50 g/mol. Its IUPAC name is 1-[(1S,3S)-3-butyl-6,8-difluoro-1-(4-hydroxycyclohexyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one.
| Compound Name | 1-[(1S,3S)-3-butyl-6,8-difluoro-1-(4-hydroxycyclohexyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 164823347 |
| Molecular Formula | C24H28F2N2O2 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 1-[(1S,3S)-3-butyl-6,8-difluoro-1-(4-hydroxycyclohexyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one |
| SMILES | C#CC(=O)N1[C@@H](CCCC)Cc2c([nH]c3c(F)cc(F)cc23)[C@@H]1C1CCC(O)CC1 |
| InChI | InChI=1S/C24H28F2N2O2/c1-3-5-6-16-13-19-18-11-15(25)12-20(26)22(18)27-23(19)24(28(16)21(30)4-2)14-7-9-17(29)10-8-14/h2,11-12,14,16-17,24,27,29H,3,5-10,13H2,1H3/t14?,16-,17?,24-/m0/s1 |
| InChIKey | PIUMGEUDTSKPRE-ASPKPATCSA-N |
| XLogP | 4.61 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|