C20H15F2N3O — CID 156644945
1-[1-(4-aminophenyl)-6,8-difluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one (PubChem CID 156644945) has the molecular formula C20H15F2N3O and a molecular weight of 351.36 g/mol. Its IUPAC name is 1-[1-(4-aminophenyl)-6,8-difluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one.
| Compound Name | 1-[1-(4-aminophenyl)-6,8-difluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 156644945 |
| Molecular Formula | C20H15F2N3O |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 1-[1-(4-aminophenyl)-6,8-difluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one |
| SMILES | C#CC(=O)N1CCc2c([nH]c3c(F)cc(F)cc23)C1c1ccc(N)cc1 |
| InChI | InChI=1S/C20H15F2N3O/c1-2-17(26)25-8-7-14-15-9-12(21)10-16(22)18(15)24-19(14)20(25)11-3-5-13(23)6-4-11/h1,3-6,9-10,20,24H,7-8,23H2 |
| InChIKey | DBWKMAIWCIWWBT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|