C24H24F2IN3O3S — CID 156645037
[3-[6,8-difluoro-1-(4-nitrophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-ynyl] thiohypoiodite;ethane (PubChem CID 156645037) has the molecular formula C24H24F2IN3O3S and a molecular weight of 599.44 g/mol. Its IUPAC name is [3-[6,8-difluoro-1-(4-nitrophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-ynyl] thiohypoiodite;ethane.
| Compound Name | [3-[6,8-difluoro-1-(4-nitrophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-ynyl] thiohypoiodite;ethane |
|---|---|
| PubChem CID | 156645037 |
| Molecular Formula | C24H24F2IN3O3S |
| Molecular Weight | 599.44 g/mol |
| Exact Mass | 599.06 |
| IUPAC Name | [3-[6,8-difluoro-1-(4-nitrophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-oxoprop-1-ynyl] thiohypoiodite;ethane |
| SMILES | CC.CC.O=C(C#CSI)N1CCc2c([nH]c3c(F)cc(F)cc23)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H12F2IN3O3S.2C2H6/c21-12-9-15-14-5-7-25(17(27)6-8-30-23)20(19(14)24-18(15)16(22)10-12)11-1-3-13(4-2-11)26(28)29;2*1-2/h1-4,9-10,20,24H,5,7H2;2*1-2H3 |
| InChIKey | CCBRRDSHEWQTGY-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.44 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|