C21H18F2N6O — CID 156644995
N,N'-diamino-4-(6,8-difluoro-2-prop-2-ynoyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)benzenecarboximidamide (PubChem CID 156644995) has the molecular formula C21H18F2N6O and a molecular weight of 408.41 g/mol. Its IUPAC name is N,N'-diamino-4-(6,8-difluoro-2-prop-2-ynoyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)benzenecarboximidamide.
| Compound Name | N,N'-diamino-4-(6,8-difluoro-2-prop-2-ynoyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 156644995 |
| Molecular Formula | C21H18F2N6O |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N,N'-diamino-4-(6,8-difluoro-2-prop-2-ynoyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)benzenecarboximidamide |
| SMILES | C#CC(=O)N1CCc2c([nH]c3c(F)cc(F)cc23)C1c1ccc(/C(=N/N)NN)cc1 |
| InChI | InChI=1S/C21H18F2N6O/c1-2-17(30)29-8-7-14-15-9-13(22)10-16(23)18(15)26-19(14)20(29)11-3-5-12(6-4-11)21(27-24)28-25/h1,3-6,9-10,20,26H,7-8,24-25H2,(H,27,28) |
| InChIKey | PCSOCTCOYKETRE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|