C33H41F2N3O3Si — CID 171054115
pentyl N-[4-[(1S,3S)-3-butyl-6,8-difluoro-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]carbamate (PubChem CID 171054115) has the molecular formula C33H41F2N3O3Si and a molecular weight of 593.79 g/mol. Its IUPAC name is pentyl N-[4-[(1S,3S)-3-butyl-6,8-difluoro-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]carbamate.
| Compound Name | pentyl N-[4-[(1S,3S)-3-butyl-6,8-difluoro-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 171054115 |
| Molecular Formula | C33H41F2N3O3Si |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | pentyl N-[4-[(1S,3S)-3-butyl-6,8-difluoro-2-(3-trimethylsilylprop-2-ynoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]carbamate |
| SMILES | CCCCCOC(=O)Nc1ccc([C@H]2c3[nH]c4c(F)cc(F)cc4c3C[C@H](CCCC)N2C(=O)C#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C33H41F2N3O3Si/c1-6-8-10-17-41-33(40)36-24-14-12-22(13-15-24)32-31-27(26-19-23(34)20-28(35)30(26)37-31)21-25(11-9-7-2)38(32)29(39)16-18-42(3,4)5/h12-15,19-20,25,32,37H,6-11,17,21H2,1-5H3,(H,36,40)/t25-,32-/m0/s1 |
| InChIKey | JWQBEDZJZSAJOX-UKJJDJLKSA-N |
| XLogP | 8.10 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|