C28H36ClF2N3O3 — CID 164823392
pentyl N-[3-[(1S,3S)-3-butyl-2-(2-chloroacetyl)-6,8-difluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1-bicyclo[1.1.1]pentanyl]carbamate (PubChem CID 164823392) has the molecular formula C28H36ClF2N3O3 and a molecular weight of 536.06 g/mol. Its IUPAC name is pentyl N-[3-[(1S,3S)-3-butyl-2-(2-chloroacetyl)-6,8-difluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1-bicyclo[1.1.1]pentanyl]carbamate.
| Compound Name | pentyl N-[3-[(1S,3S)-3-butyl-2-(2-chloroacetyl)-6,8-difluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1-bicyclo[1.1.1]pentanyl]carbamate |
|---|---|
| PubChem CID | 164823392 |
| Molecular Formula | C28H36ClF2N3O3 |
| Molecular Weight | 536.06 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | pentyl N-[3-[(1S,3S)-3-butyl-2-(2-chloroacetyl)-6,8-difluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-1-bicyclo[1.1.1]pentanyl]carbamate |
| SMILES | CCCCCOC(=O)NC12CC([C@H]3c4[nH]c5c(F)cc(F)cc5c4C[C@H](CCCC)N3C(=O)CCl)(C1)C2 |
| InChI | InChI=1S/C28H36ClF2N3O3/c1-3-5-7-9-37-26(36)33-28-14-27(15-28,16-28)25-24-20(19-10-17(30)11-21(31)23(19)32-24)12-18(8-6-4-2)34(25)22(35)13-29/h10-11,18,25,32H,3-9,12-16H2,1-2H3,(H,33,36)/t18-,25+,27?,28?/m0/s1 |
| InChIKey | VOORVUUYHDPSDD-JPUQXTHISA-N |
| XLogP | 6.51 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.06 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|