C25H30F2N4OSi — CID 171054067
1-[(1R,3S)-3-butyl-6,8-difluoro-1-(2-methylpyrazol-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-trimethylsilylprop-2-yn-1-one (PubChem CID 171054067) has the molecular formula C25H30F2N4OSi and a molecular weight of 468.62 g/mol. Its IUPAC name is 1-[(1R,3S)-3-butyl-6,8-difluoro-1-(2-methylpyrazol-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-trimethylsilylprop-2-yn-1-one.
| Compound Name | 1-[(1R,3S)-3-butyl-6,8-difluoro-1-(2-methylpyrazol-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-trimethylsilylprop-2-yn-1-one |
|---|---|
| PubChem CID | 171054067 |
| Molecular Formula | C25H30F2N4OSi |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 1-[(1R,3S)-3-butyl-6,8-difluoro-1-(2-methylpyrazol-3-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-trimethylsilylprop-2-yn-1-one |
| SMILES | CCCC[C@H]1Cc2c([nH]c3c(F)cc(F)cc23)[C@H](c2ccnn2C)N1C(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C25H30F2N4OSi/c1-6-7-8-17-15-19-18-13-16(26)14-20(27)23(18)29-24(19)25(21-9-11-28-30(21)2)31(17)22(32)10-12-33(3,4)5/h9,11,13-14,17,25,29H,6-8,15H2,1-5H3/t17-,25-/m0/s1 |
| InChIKey | KSPRZJGACNZENQ-GKVSMKOHSA-N |
| XLogP | 5.09 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|