C18H20N4 — CID 101232585
2-[(3S)-3-(aminomethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]aniline (PubChem CID 101232585) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 2-[(3S)-3-(aminomethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]aniline.
| Compound Name | 2-[(3S)-3-(aminomethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]aniline |
|---|---|
| PubChem CID | 101232585 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-[(3S)-3-(aminomethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]aniline |
| SMILES | NC[C@@H]1Cc2c([nH]c3ccccc23)C(c2ccccc2N)N1 |
| InChI | InChI=1S/C18H20N4/c19-10-11-9-14-12-5-2-4-8-16(12)22-18(14)17(21-11)13-6-1-3-7-15(13)20/h1-8,11,17,21-22H,9-10,19-20H2/t11-,17?/m0/s1 |
| InChIKey | ZEGMMNAJKJYDSL-PIJUOJQZSA-N |
| XLogP | 2.31 |
| TPSA | 79.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|