C12H14BrNO2 — CID 691917
4-bromo-2-[[(2R)-oxolan-2-yl]methyliminomethyl]phenol (PubChem CID 691917) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is 4-bromo-2-[[(2R)-oxolan-2-yl]methyliminomethyl]phenol.
| Compound Name | 4-bromo-2-[[(2R)-oxolan-2-yl]methyliminomethyl]phenol |
|---|---|
| PubChem CID | 691917 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 4-bromo-2-[[(2R)-oxolan-2-yl]methyliminomethyl]phenol |
| SMILES | Oc1ccc(Br)cc1/C=N/C[C@H]1CCCO1 |
| InChI | InChI=1S/C12H14BrNO2/c13-10-3-4-12(15)9(6-10)7-14-8-11-2-1-5-16-11/h3-4,6-7,11,15H,1-2,5,8H2/b14-7+/t11-/m1/s1 |
| InChIKey | MKBDPOJYGPNTNV-LLUUXILJSA-N |
| XLogP | 2.75 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|