C22H27ClN6O3S — CID 69197873
7-[3-(1,3,5,7-tetrazatricyclo[3.3.1.13,7]decan-2-yl)phenoxy]-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide;hydrochloride (PubChem CID 69197873) has the molecular formula C22H27ClN6O3S and a molecular weight of 491.02 g/mol. Its IUPAC name is 7-[3-(1,3,5,7-tetrazatricyclo[3.3.1.13,7]decan-2-yl)phenoxy]-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide;hydrochloride.
| Compound Name | 7-[3-(1,3,5,7-tetrazatricyclo[3.3.1.13,7]decan-2-yl)phenoxy]-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide;hydrochloride |
|---|---|
| PubChem CID | 69197873 |
| Molecular Formula | C22H27ClN6O3S |
| Molecular Weight | 491.02 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 7-[3-(1,3,5,7-tetrazatricyclo[3.3.1.13,7]decan-2-yl)phenoxy]-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide;hydrochloride |
| SMILES | Cl.O=S1(=O)NC2CCCN2c2ccc(Oc3cccc(C4N5CN6CN(C5)CN4C6)c3)cc21 |
| InChI | InChI=1S/C22H26N6O3S.ClH/c29-32(30)20-10-18(6-7-19(20)28-8-2-5-21(28)23-32)31-17-4-1-3-16(9-17)22-26-12-24-11-25(14-26)15-27(22)13-24;/h1,3-4,6-7,9-10,21-23H,2,5,8,11-15H2;1H |
| InChIKey | GOQBOQKTWNJHKZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.02 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |