C20H23N3O2S — CID 91614575
4-[3-(2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-7-yloxy)phenyl]morpholine (PubChem CID 91614575) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 4-[3-(2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-7-yloxy)phenyl]morpholine.
| Compound Name | 4-[3-(2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-7-yloxy)phenyl]morpholine |
|---|---|
| PubChem CID | 91614575 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-[3-(2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazin-7-yloxy)phenyl]morpholine |
| SMILES | c1cc(Oc2ccc3c(c2)SNC2CCCN32)cc(N2CCOCC2)c1 |
| InChI | InChI=1S/C20H23N3O2S/c1-3-15(22-9-11-24-12-10-22)13-16(4-1)25-17-6-7-18-19(14-17)26-21-20-5-2-8-23(18)20/h1,3-4,6-7,13-14,20-21H,2,5,8-12H2 |
| InChIKey | WNJCGUAVALVNLQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|