C16H15BrN2OS — CID 123731738
7-(3-bromophenoxy)-4-cyclopropyl-2,3-dihydro-1,2,4-benzothiadiazine (PubChem CID 123731738) has the molecular formula C16H15BrN2OS and a molecular weight of 363.28 g/mol. Its IUPAC name is 7-(3-bromophenoxy)-4-cyclopropyl-2,3-dihydro-1,2,4-benzothiadiazine.
| Compound Name | 7-(3-bromophenoxy)-4-cyclopropyl-2,3-dihydro-1,2,4-benzothiadiazine |
|---|---|
| PubChem CID | 123731738 |
| Molecular Formula | C16H15BrN2OS |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 7-(3-bromophenoxy)-4-cyclopropyl-2,3-dihydro-1,2,4-benzothiadiazine |
| SMILES | Brc1cccc(Oc2ccc3c(c2)SNCN3C2CC2)c1 |
| InChI | InChI=1S/C16H15BrN2OS/c17-11-2-1-3-13(8-11)20-14-6-7-15-16(9-14)21-18-10-19(15)12-4-5-12/h1-3,6-9,12,18H,4-5,10H2 |
| InChIKey | JTEDEXJGPNXNCG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|