C14H14N2OS — CID 91593954
4-methyl-7-phenoxy-2,3-dihydro-1,2,4-benzothiadiazine (PubChem CID 91593954) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is 4-methyl-7-phenoxy-2,3-dihydro-1,2,4-benzothiadiazine.
| Compound Name | 4-methyl-7-phenoxy-2,3-dihydro-1,2,4-benzothiadiazine |
|---|---|
| PubChem CID | 91593954 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-methyl-7-phenoxy-2,3-dihydro-1,2,4-benzothiadiazine |
| SMILES | CN1CNSc2cc(Oc3ccccc3)ccc21 |
| InChI | InChI=1S/C14H14N2OS/c1-16-10-15-18-14-9-12(7-8-13(14)16)17-11-5-3-2-4-6-11/h2-9,15H,10H2,1H3 |
| InChIKey | XIMVPZSMBWLOSY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|