C18H14F6N2OS — CID 90775281
7-[3,5-bis(trifluoromethyl)phenoxy]-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine (PubChem CID 90775281) has the molecular formula C18H14F6N2OS and a molecular weight of 420.38 g/mol. Its IUPAC name is 7-[3,5-bis(trifluoromethyl)phenoxy]-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine.
| Compound Name | 7-[3,5-bis(trifluoromethyl)phenoxy]-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine |
|---|---|
| PubChem CID | 90775281 |
| Molecular Formula | C18H14F6N2OS |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 7-[3,5-bis(trifluoromethyl)phenoxy]-2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine |
| SMILES | FC(F)(F)c1cc(Oc2ccc3c(c2)SNC2CCCN32)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F6N2OS/c19-17(20,21)10-6-11(18(22,23)24)8-13(7-10)27-12-3-4-14-15(9-12)28-25-16-2-1-5-26(14)16/h3-4,6-9,16,25H,1-2,5H2 |
| InChIKey | NQILBYLFDIWYEL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|