C22H27FN4O — CID 171539670
4-[2-[(3aR,7aR)-4-(3-fluorophenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-4-pyridinyl]morpholine (PubChem CID 171539670) has the molecular formula C22H27FN4O and a molecular weight of 382.48 g/mol. Its IUPAC name is 4-[2-[(3aR,7aR)-4-(3-fluorophenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-4-pyridinyl]morpholine.
| Compound Name | 4-[2-[(3aR,7aR)-4-(3-fluorophenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-4-pyridinyl]morpholine |
|---|---|
| PubChem CID | 171539670 |
| Molecular Formula | C22H27FN4O |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 4-[2-[(3aR,7aR)-4-(3-fluorophenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-4-pyridinyl]morpholine |
| SMILES | Fc1cccc(N2CCC[C@@H]3[C@H]2CCN3c2cc(N3CCOCC3)ccn2)c1 |
| InChI | InChI=1S/C22H27FN4O/c23-17-3-1-4-19(15-17)26-9-2-5-20-21(26)7-10-27(20)22-16-18(6-8-24-22)25-11-13-28-14-12-25/h1,3-4,6,8,15-16,20-21H,2,5,7,9-14H2/t20-,21-/m1/s1 |
| InChIKey | XDESOXFZWJSSCP-NHCUHLMSSA-N |
| XLogP | 3.31 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |