C32H49FN4O3 — CID 176933102
(3S,3aS,7aS)-4-(3-fluorophenyl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1-(4-piperidin-1-yl-2-pyridinyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine;ethane (PubChem CID 176933102) has the molecular formula C32H49FN4O3 and a molecular weight of 556.77 g/mol. Its IUPAC name is (3S,3aS,7aS)-4-(3-fluorophenyl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1-(4-piperidin-1-yl-2-pyridinyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine;ethane.
| Compound Name | (3S,3aS,7aS)-4-(3-fluorophenyl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1-(4-piperidin-1-yl-2-pyridinyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine;ethane |
|---|---|
| PubChem CID | 176933102 |
| Molecular Formula | C32H49FN4O3 |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.38 |
| IUPAC Name | (3S,3aS,7aS)-4-(3-fluorophenyl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1-(4-piperidin-1-yl-2-pyridinyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine;ethane |
| SMILES | CC.COCCOCCOCC[C@H]1CN(c2cc(N3CCCCC3)ccn2)[C@H]2CCCN(c3cccc(F)c3)[C@@H]12 |
| InChI | InChI=1S/C30H43FN4O3.C2H6/c1-36-17-18-38-20-19-37-16-11-24-23-35(29-22-26(10-12-32-29)33-13-3-2-4-14-33)28-9-6-15-34(30(24)28)27-8-5-7-25(31)21-27;1-2/h5,7-8,10,12,21-22,24,28,30H,2-4,6,9,11,13-20,23H2,1H3;1-2H3/t24-,28-,30-;/m0./s1 |
| InChIKey | AWEDPGZMLYULPA-DHOODLJNSA-N |
| XLogP | 5.78 |
| TPSA | 50.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|