C25H32N4 — CID 171540454
(3aR,7aR)-1-[4-(3-azabicyclo[3.1.1]heptan-3-yl)-2-pyridinyl]-4-(3-methylphenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine (PubChem CID 171540454) has the molecular formula C25H32N4 and a molecular weight of 388.56 g/mol. Its IUPAC name is (3aR,7aR)-1-[4-(3-azabicyclo[3.1.1]heptan-3-yl)-2-pyridinyl]-4-(3-methylphenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine.
| Compound Name | (3aR,7aR)-1-[4-(3-azabicyclo[3.1.1]heptan-3-yl)-2-pyridinyl]-4-(3-methylphenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 171540454 |
| Molecular Formula | C25H32N4 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (3aR,7aR)-1-[4-(3-azabicyclo[3.1.1]heptan-3-yl)-2-pyridinyl]-4-(3-methylphenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine |
| SMILES | Cc1cccc(N2CCC[C@@H]3[C@H]2CCN3c2cc(N3CC4CC(C4)C3)ccn2)c1 |
| InChI | InChI=1S/C25H32N4/c1-18-4-2-5-22(12-18)28-10-3-6-23-24(28)8-11-29(23)25-15-21(7-9-26-25)27-16-19-13-20(14-19)17-27/h2,4-5,7,9,12,15,19-20,23-24H,3,6,8,10-11,13-14,16-17H2,1H3/t19?,20?,23-,24-/m1/s1 |
| InChIKey | WMOZALKRRPBZRN-KBTIEJEYSA-N |
| XLogP | 4.48 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |