C23H29FN4O — CID 176995802
(3S)-1-[2-[(7aR)-4-(3-fluorophenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-4-pyridinyl]piperidin-3-ol (PubChem CID 176995802) has the molecular formula C23H29FN4O and a molecular weight of 396.51 g/mol. Its IUPAC name is (3S)-1-[2-[(7aR)-4-(3-fluorophenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-4-pyridinyl]piperidin-3-ol.
| Compound Name | (3S)-1-[2-[(7aR)-4-(3-fluorophenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-4-pyridinyl]piperidin-3-ol |
|---|---|
| PubChem CID | 176995802 |
| Molecular Formula | C23H29FN4O |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (3S)-1-[2-[(7aR)-4-(3-fluorophenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl]-4-pyridinyl]piperidin-3-ol |
| SMILES | O[C@H]1CCCN(c2ccnc(N3CCC4[C@H]3CCCN4c3cccc(F)c3)c2)C1 |
| InChI | InChI=1S/C23H29FN4O/c24-17-4-1-5-19(14-17)27-12-3-7-21-22(27)9-13-28(21)23-15-18(8-10-25-23)26-11-2-6-20(29)16-26/h1,4-5,8,10,14-15,20-22,29H,2-3,6-7,9,11-13,16H2/t20-,21+,22?/m0/s1 |
| InChIKey | QGBZFTKWSLBNME-UGGDCYSXSA-N |
| XLogP | 3.43 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |