C31H29N5O5 — CID 69198472
2-[2-[1-(6-carbamimidoyl-1H-indol-3-yl)propyl]-5-(1,3-oxazol-2-ylmethylcarbamoyl)phenyl]-5-methoxybenzoic acid (PubChem CID 69198472) has the molecular formula C31H29N5O5 and a molecular weight of 551.60 g/mol. Its IUPAC name is 2-[2-[1-(6-carbamimidoyl-1H-indol-3-yl)propyl]-5-(1,3-oxazol-2-ylmethylcarbamoyl)phenyl]-5-methoxybenzoic acid.
| Compound Name | 2-[2-[1-(6-carbamimidoyl-1H-indol-3-yl)propyl]-5-(1,3-oxazol-2-ylmethylcarbamoyl)phenyl]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 69198472 |
| Molecular Formula | C31H29N5O5 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 2-[2-[1-(6-carbamimidoyl-1H-indol-3-yl)propyl]-5-(1,3-oxazol-2-ylmethylcarbamoyl)phenyl]-5-methoxybenzoic acid |
| SMILES | [H]/N=C(\N)c1ccc2c(C(CC)c3ccc(C(=O)NCc4ncco4)cc3-c3ccc(OC)cc3C(=O)O)c[nH]c2c1 |
| InChI | InChI=1S/C31H29N5O5/c1-3-20(26-15-35-27-13-17(29(32)33)4-8-23(26)27)21-7-5-18(30(37)36-16-28-34-10-11-41-28)12-24(21)22-9-6-19(40-2)14-25(22)31(38)39/h4-15,20,35H,3,16H2,1-2H3,(H3,32,33)(H,36,37)(H,38,39) |
| InChIKey | OOSLAORFGZXTQI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 167.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|