C22H24N4O4S — CID 69206665
benzyl N-(7,17-dioxo-7λ4-thia-1,13,15-triazatetracyclo[7.7.1.02,6.011,16]heptadeca-9,11,13,15-tetraen-8-yl)carbamate;methane (PubChem CID 69206665) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is benzyl N-(7,17-dioxo-7λ4-thia-1,13,15-triazatetracyclo[7.7.1.02,6.011,16]heptadeca-9,11,13,15-tetraen-8-yl)carbamate;methane.
| Compound Name | benzyl N-(7,17-dioxo-7λ4-thia-1,13,15-triazatetracyclo[7.7.1.02,6.011,16]heptadeca-9,11,13,15-tetraen-8-yl)carbamate;methane |
|---|---|
| PubChem CID | 69206665 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | benzyl N-(7,17-dioxo-7λ4-thia-1,13,15-triazatetracyclo[7.7.1.02,6.011,16]heptadeca-9,11,13,15-tetraen-8-yl)carbamate;methane |
| SMILES | C.O=C(NC1c2cc3cncnc3n(c2=O)C2CCCC2S1=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H20N4O4S.CH4/c26-20-15-9-14-10-22-12-23-18(14)25(20)16-7-4-8-17(16)30(28)19(15)24-21(27)29-11-13-5-2-1-3-6-13;/h1-3,5-6,9-10,12,16-17,19H,4,7-8,11H2,(H,24,27);1H4 |
| InChIKey | ZTSJOPCDLXNHQR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |