About (2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol
(2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol (PubChem CID 69207984) has the molecular formula C18H21OPS
and a molecular weight of 316.41 g/mol. Its IUPAC name is (2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol |
| PubChem CID | 69207984 |
| Molecular Formula | C18H21OPS |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol |
| SMILES | O[C@@]1(CCc2ccccc2)CCCP1(=S)c1ccccc1 |
| InChI | InChI=1S/C18H21OPS/c19-18(14-12-16-8-3-1-4-9-16)13-7-15-20(18,21)17-10-5-2-6-11-17/h1-6,8-11,19H,7,12-15H2/t18-,20?/m0/s1 |
| InChIKey | IUJOJXWPFUQFOM-LROBGIAVSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol?
The IUPAC name of (2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol (CID 69207984) is (2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol.
What is the SMILES notation for (2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol?
The canonical SMILES for (2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol is O[C@@]1(CCc2ccccc2)CCCP1(=S)c1ccccc1.
What is the InChIKey of (2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol?
The InChIKey is IUJOJXWPFUQFOM-LROBGIAVSA-N. The full InChI is InChI=1S/C18H21OPS/c19-18(14-12-16-8-3-1-4-9-16)13-7-15-20(18,21)17-10-5-2-6-11-17/h1-6,8-11,19H,7,12-15H2/t18-,20?/m0/s1.
What are the key properties of (2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol?
(2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol has a molecular weight of 316.41 g/mol, XLogP of 3.91, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-phenyl-2-(2-phenylethyl)-1-sulfanylidene-1λ5-phospholan-2-ol is sourced from PubChem (CID 69207984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).